About N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline (PubChem CID 677470) has the molecular formula C14H10BrF2NO2
and a molecular weight of 342.14 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline.
Molecular Properties
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline |
| PubChem CID | 677470 |
| Molecular Formula | C14H10BrF2NO2 |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline |
| SMILES | Fc1ccc(NCc2cc3c(cc2Br)OCO3)c(F)c1 |
| InChI | InChI=1S/C14H10BrF2NO2/c15-10-5-14-13(19-7-20-14)3-8(10)6-18-12-2-1-9(16)4-11(12)17/h1-5,18H,6-7H2 |
| InChIKey | JDCNOOMHGRFWSY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline?
The IUPAC name of N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline (CID 677470) is N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline.
What is the SMILES notation for N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline?
The canonical SMILES for N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline is Fc1ccc(NCc2cc3c(cc2Br)OCO3)c(F)c1.
What is the InChIKey of N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline?
The InChIKey is JDCNOOMHGRFWSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrF2NO2/c15-10-5-14-13(19-7-20-14)3-8(10)6-18-12-2-1-9(16)4-11(12)17/h1-5,18H,6-7H2.
What are the key properties of N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline?
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline has a molecular weight of 342.14 g/mol, XLogP of 4.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2,4-difluoroaniline is sourced from PubChem (CID 677470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).