About 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane
1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane (PubChem CID 67747117) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane |
| PubChem CID | 67747117 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane |
| SMILES | C=COC(=C)C1(C)CCC(C)CC1 |
| InChI | InChI=1S/C12H20O/c1-5-13-11(3)12(4)8-6-10(2)7-9-12/h5,10H,1,3,6-9H2,2,4H3 |
| InChIKey | FTANWJAVIXQQLK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane?
The IUPAC name of 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane (CID 67747117) is 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane.
What is the SMILES notation for 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane?
The canonical SMILES for 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane is C=COC(=C)C1(C)CCC(C)CC1.
What is the InChIKey of 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane?
The InChIKey is FTANWJAVIXQQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O/c1-5-13-11(3)12(4)8-6-10(2)7-9-12/h5,10H,1,3,6-9H2,2,4H3.
What are the key properties of 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane?
1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane has a molecular weight of 180.29 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethenoxyethenyl)-1,4-dimethylcyclohexane is sourced from PubChem (CID 67747117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).