About 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid
2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid (PubChem CID 67747125) has the molecular formula C24H24NO7P
and a molecular weight of 469.43 g/mol. Its IUPAC name is 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid.
Molecular Properties
| Compound Name | 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid |
| PubChem CID | 67747125 |
| Molecular Formula | C24H24NO7P |
| Molecular Weight | 469.43 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid |
| SMILES | Cc1cc(C(=O)O)cc2ccccc12.Nc1ccccc1-c1ccccc1O.O=P(O)(O)O |
| InChI | InChI=1S/C12H11NO.C12H10O2.H3O4P/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14;1-8-6-10(12(13)14)7-9-4-2-3-5-11(8)9;1-5(2,3)4/h1-8,14H,13H2;2-7H,1H3,(H,13,14);(H3,1,2,3,4) |
| InChIKey | WYMWEEURMUYHOV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 161.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid?
The IUPAC name of 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid (CID 67747125) is 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid.
What is the SMILES notation for 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid?
The canonical SMILES for 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid is Cc1cc(C(=O)O)cc2ccccc12.Nc1ccccc1-c1ccccc1O.O=P(O)(O)O.
What is the InChIKey of 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid?
The InChIKey is WYMWEEURMUYHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO.C12H10O2.H3O4P/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14;1-8-6-10(12(13)14)7-9-4-2-3-5-11(8)9;1-5(2,3)4/h1-8,14H,13H2;2-7H,1H3,(H,13,14);(H3,1,2,3,4).
What are the key properties of 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid?
2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid has a molecular weight of 469.43 g/mol, XLogP of 4.56, 2 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminophenyl)phenol;4-methylnaphthalene-2-carboxylic acid;phosphoric acid is sourced from PubChem (CID 67747125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).