About 5-aminocyclohexa-1,3-diene-1,3,5-triol
5-aminocyclohexa-1,3-diene-1,3,5-triol (PubChem CID 67747300) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 5-aminocyclohexa-1,3-diene-1,3,5-triol.
Molecular Properties
| Compound Name | 5-aminocyclohexa-1,3-diene-1,3,5-triol |
| PubChem CID | 67747300 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 5-aminocyclohexa-1,3-diene-1,3,5-triol |
| SMILES | NC1(O)C=C(O)C=C(O)C1 |
| InChI | InChI=1S/C6H9NO3/c7-6(10)2-4(8)1-5(9)3-6/h1-2,8-10H,3,7H2 |
| InChIKey | NMMAAZGCIKJWSJ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-aminocyclohexa-1,3-diene-1,3,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminocyclohexa-1,3-diene-1,3,5-triol?
The IUPAC name of 5-aminocyclohexa-1,3-diene-1,3,5-triol (CID 67747300) is 5-aminocyclohexa-1,3-diene-1,3,5-triol.
What is the SMILES notation for 5-aminocyclohexa-1,3-diene-1,3,5-triol?
The canonical SMILES for 5-aminocyclohexa-1,3-diene-1,3,5-triol is NC1(O)C=C(O)C=C(O)C1.
What is the InChIKey of 5-aminocyclohexa-1,3-diene-1,3,5-triol?
The InChIKey is NMMAAZGCIKJWSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c7-6(10)2-4(8)1-5(9)3-6/h1-2,8-10H,3,7H2.
What are the key properties of 5-aminocyclohexa-1,3-diene-1,3,5-triol?
5-aminocyclohexa-1,3-diene-1,3,5-triol has a molecular weight of 143.14 g/mol, XLogP of -0.08, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminocyclohexa-1,3-diene-1,3,5-triol is sourced from PubChem (CID 67747300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).