C33H41NO6Si — CID 67747301
(4S)-4-benzyl-3-[(2S,3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methoxy-2-methylpentanoyl]-1,3-oxazolidin-2-one (PubChem CID 67747301) has the molecular formula C33H41NO6Si and a molecular weight of 575.78 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methoxy-2-methylpentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methoxy-2-methylpentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67747301 |
| Molecular Formula | C33H41NO6Si |
| Molecular Weight | 575.78 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-4-methoxy-2-methylpentanoyl]-1,3-oxazolidin-2-one |
| SMILES | CO[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](O)[C@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C33H41NO6Si/c1-24(31(36)34-26(22-39-32(34)37)21-25-15-9-6-10-16-25)30(35)29(38-5)23-40-41(33(2,3)4,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-20,24,26,29-30,35H,21-23H2,1-5H3/t24-,26-,29-,30-/m0/s1 |
| InChIKey | JTEUKFNNCSNYOJ-YZNHBJMQSA-N |
| XLogP | 4.17 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.78 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|