C22H44O3Si2 — CID 67747483
trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-butylidenecyclohexan-1-one (PubChem CID 67747483) has the molecular formula C22H44O3Si2 and a molecular weight of 412.76 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-butylidenecyclohexan-1-one.
| Compound Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-butylidenecyclohexan-1-one |
|---|---|
| PubChem CID | 67747483 |
| Molecular Formula | C22H44O3Si2 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | trans-(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-butylidenecyclohexan-1-one |
| SMILES | CCCC=C1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O3Si2/c1-12-13-14-18-19(24-26(8,9)21(2,3)4)15-17(23)16-20(18)25-27(10,11)22(5,6)7/h14,19-20H,12-13,15-16H2,1-11H3/t19-,20-/m1/s1 |
| InChIKey | AAAVHASNHNYZTN-WOJBJXKFSA-N |
| XLogP | 6.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|