C19H28O2 — CID 67747666
5-methyl-5-[5-(1-methylcyclohexa-2,4-dien-1-yl)oxypentoxy]cyclohexa-1,3-diene (PubChem CID 67747666) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 5-methyl-5-[5-(1-methylcyclohexa-2,4-dien-1-yl)oxypentoxy]cyclohexa-1,3-diene.
| Compound Name | 5-methyl-5-[5-(1-methylcyclohexa-2,4-dien-1-yl)oxypentoxy]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 67747666 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 5-methyl-5-[5-(1-methylcyclohexa-2,4-dien-1-yl)oxypentoxy]cyclohexa-1,3-diene |
| SMILES | CC1(OCCCCCOC2(C)C=CC=CC2)C=CC=CC1 |
| InChI | InChI=1S/C19H28O2/c1-18(12-6-3-7-13-18)20-16-10-5-11-17-21-19(2)14-8-4-9-15-19/h3-4,6-9,12,14H,5,10-11,13,15-17H2,1-2H3 |
| InChIKey | NLWQNCQXCIIBPF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|