About 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride
2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride (PubChem CID 67747686) has the molecular formula C7H12ClF3N4
and a molecular weight of 244.65 g/mol. Its IUPAC name is 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride |
| PubChem CID | 67747686 |
| Molecular Formula | C7H12ClF3N4 |
| Molecular Weight | 244.65 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride |
| SMILES | Cl.NC(N)=NN=CC(C1CC1)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N4.ClH/c8-7(9,10)5(4-1-2-4)3-13-14-6(11)12;/h3-5H,1-2H2,(H4,11,12,14);1H |
| InChIKey | HXUYJRWALZQZMT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.65 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride?
The IUPAC name of 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride (CID 67747686) is 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride.
What is the SMILES notation for 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride?
The canonical SMILES for 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride is Cl.NC(N)=NN=CC(C1CC1)C(F)(F)F.
What is the InChIKey of 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride?
The InChIKey is HXUYJRWALZQZMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3N4.ClH/c8-7(9,10)5(4-1-2-4)3-13-14-6(11)12;/h3-5H,1-2H2,(H4,11,12,14);1H.
What are the key properties of 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride?
2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride has a molecular weight of 244.65 g/mol, XLogP of 1.26, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-cyclopropyl-3,3,3-trifluoropropylidene)amino]guanidine;hydrochloride is sourced from PubChem (CID 67747686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).