About CID 67747688
CID 67747688 (PubChem CID 67747688) has the molecular formula C46H50F3N8O4Si
and a molecular weight of 864.04 g/mol.
Molecular Properties
| Compound Name | CID 67747688 |
| PubChem CID | 67747688 |
| Molecular Formula | C46H50F3N8O4Si |
| Molecular Weight | 864.04 g/mol |
| Exact Mass | 863.37 |
| IUPAC Name | — |
| SMILES | CC(C)C(NC(=O)Cn1c(-c2ccccc2)ccc(NC(=O)Nc2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1=O)(O[Si](C)C)C(C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C46H50F3N8O4Si/c1-31(2)45(61-62(6)7,40(43(3,4)5)46(47,48)49)52-38(58)30-56-37(32-20-12-8-13-21-32)29-28-36(39(56)59)50-42(60)51-41-53-54-55-57(41)44(33-22-14-9-15-23-33,34-24-16-10-17-25-34)35-26-18-11-19-27-35/h8-29,31,40H,30H2,1-7H3,(H,52,58)(H2,50,51,53,55,60) |
| InChIKey | LVVRDSFPDYSWIQ-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 145.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 864.04 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 67747688 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67747688?
The IUPAC name of CID 67747688 (CID 67747688) is not available.
What is the SMILES notation for CID 67747688?
The canonical SMILES for CID 67747688 is CC(C)C(NC(=O)Cn1c(-c2ccccc2)ccc(NC(=O)Nc2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)c1=O)(O[Si](C)C)C(C(C)(C)C)C(F)(F)F.
What is the InChIKey of CID 67747688?
The InChIKey is LVVRDSFPDYSWIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H50F3N8O4Si/c1-31(2)45(61-62(6)7,40(43(3,4)5)46(47,48)49)52-38(58)30-56-37(32-20-12-8-13-21-32)29-28-36(39(56)59)50-42(60)51-41-53-54-55-57(41)44(33-22-14-9-15-23-33,34-24-16-10-17-25-34)35-26-18-11-19-27-35/h8-29,31,40H,30H2,1-7H3,(H,52,58)(H2,50,51,53,55,60).
What are the key properties of CID 67747688?
CID 67747688 has a molecular weight of 864.04 g/mol, XLogP of 8.95, 14 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67747688 is sourced from PubChem (CID 67747688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).