C18H22N2O4 — CID 67747738
6-(3,5-dimethylphenoxy)-5-ethyl-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione (PubChem CID 67747738) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 6-(3,5-dimethylphenoxy)-5-ethyl-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(3,5-dimethylphenoxy)-5-ethyl-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67747738 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 6-(3,5-dimethylphenoxy)-5-ethyl-3-[(E)-4-hydroxybut-2-enyl]-1H-pyrimidine-2,4-dione |
| SMILES | CCc1c(Oc2cc(C)cc(C)c2)[nH]c(=O)n(C/C=C/CO)c1=O |
| InChI | InChI=1S/C18H22N2O4/c1-4-15-16(24-14-10-12(2)9-13(3)11-14)19-18(23)20(17(15)22)7-5-6-8-21/h5-6,9-11,21H,4,7-8H2,1-3H3,(H,19,23)/b6-5+ |
| InChIKey | VZMPOQWMCRQEOC-AATRIKPKSA-N |
| XLogP | 2.06 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|