About pteridine;pteridine-2,4-diamine
pteridine;pteridine-2,4-diamine (PubChem CID 67748436) has the molecular formula C12H10N10
and a molecular weight of 294.28 g/mol. Its IUPAC name is pteridine;pteridine-2,4-diamine.
Molecular Properties
| Compound Name | pteridine;pteridine-2,4-diamine |
| PubChem CID | 67748436 |
| Molecular Formula | C12H10N10 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | pteridine;pteridine-2,4-diamine |
| SMILES | Nc1nc(N)c2nccnc2n1.c1cnc2ncncc2n1 |
| InChI | InChI=1S/C6H6N6.C6H4N4/c7-4-3-5(10-2-1-9-3)12-6(8)11-4;1-2-9-6-5(8-1)3-7-4-10-6/h1-2H,(H4,7,8,10,11,12);1-4H |
| InChIKey | UYBWWFJCQUVAQK-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze pteridine;pteridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pteridine;pteridine-2,4-diamine?
The IUPAC name of pteridine;pteridine-2,4-diamine (CID 67748436) is pteridine;pteridine-2,4-diamine.
What is the SMILES notation for pteridine;pteridine-2,4-diamine?
The canonical SMILES for pteridine;pteridine-2,4-diamine is Nc1nc(N)c2nccnc2n1.c1cnc2ncncc2n1.
What is the InChIKey of pteridine;pteridine-2,4-diamine?
The InChIKey is UYBWWFJCQUVAQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N6.C6H4N4/c7-4-3-5(10-2-1-9-3)12-6(8)11-4;1-2-9-6-5(8-1)3-7-4-10-6/h1-2H,(H4,7,8,10,11,12);1-4H.
What are the key properties of pteridine;pteridine-2,4-diamine?
pteridine;pteridine-2,4-diamine has a molecular weight of 294.28 g/mol, XLogP of 0.00, 0 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for pteridine;pteridine-2,4-diamine is sourced from PubChem (CID 67748436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).