About butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate
butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate (PubChem CID 67748480) has the molecular formula C24H19Cl2F3N2O2
and a molecular weight of 495.33 g/mol. Its IUPAC name is butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate.
Molecular Properties
| Compound Name | butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate |
| PubChem CID | 67748480 |
| Molecular Formula | C24H19Cl2F3N2O2 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate |
| SMILES | CCCCOC(=O)Cn1c(-c2ccc(Cl)cc2)c(C#N)c(-c2ccc(Cl)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C24H19Cl2F3N2O2/c1-2-3-12-33-20(32)14-31-22(16-6-10-18(26)11-7-16)19(13-30)21(23(31)24(27,28)29)15-4-8-17(25)9-5-15/h4-11H,2-3,12,14H2,1H3 |
| InChIKey | IMYPZBSRKXDBLS-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate?
The IUPAC name of butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate (CID 67748480) is butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate.
What is the SMILES notation for butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate?
The canonical SMILES for butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate is CCCCOC(=O)Cn1c(-c2ccc(Cl)cc2)c(C#N)c(-c2ccc(Cl)cc2)c1C(F)(F)F.
What is the InChIKey of butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate?
The InChIKey is IMYPZBSRKXDBLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19Cl2F3N2O2/c1-2-3-12-33-20(32)14-31-22(16-6-10-18(26)11-7-16)19(13-30)21(23(31)24(27,28)29)15-4-8-17(25)9-5-15/h4-11H,2-3,12,14H2,1H3.
What are the key properties of butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate?
butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate has a molecular weight of 495.33 g/mol, XLogP of 7.36, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-[2,4-bis(4-chlorophenyl)-3-cyano-5-(trifluoromethyl)pyrrol-1-yl]acetate is sourced from PubChem (CID 67748480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).