About benzhydrylidenecyanamide
benzhydrylidenecyanamide (PubChem CID 677486) has the molecular formula C14H10N2
and a molecular weight of 206.25 g/mol. Its IUPAC name is benzhydrylidenecyanamide.
Molecular Properties
| Compound Name | benzhydrylidenecyanamide |
| PubChem CID | 677486 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | benzhydrylidenecyanamide |
| SMILES | N#CN=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H10N2/c15-11-16-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H |
| InChIKey | HGCFJCRRNADPPY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylidenecyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylidenecyanamide?
The IUPAC name of benzhydrylidenecyanamide (CID 677486) is benzhydrylidenecyanamide.
What is the SMILES notation for benzhydrylidenecyanamide?
The canonical SMILES for benzhydrylidenecyanamide is N#CN=C(c1ccccc1)c1ccccc1.
What is the InChIKey of benzhydrylidenecyanamide?
The InChIKey is HGCFJCRRNADPPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2/c15-11-16-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H.
What are the key properties of benzhydrylidenecyanamide?
benzhydrylidenecyanamide has a molecular weight of 206.25 g/mol, XLogP of 3.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylidenecyanamide is sourced from PubChem (CID 677486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).