C17H26ClNO — CID 67749546
(2R,3S)-8-methoxy-3-prop-2-enyl-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride (PubChem CID 67749546) has the molecular formula C17H26ClNO and a molecular weight of 295.85 g/mol. Its IUPAC name is (2R,3S)-8-methoxy-3-prop-2-enyl-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride.
| Compound Name | (2R,3S)-8-methoxy-3-prop-2-enyl-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 67749546 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (2R,3S)-8-methoxy-3-prop-2-enyl-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine;hydrochloride |
| SMILES | C=CC[C@H]1Cc2cccc(OC)c2C[C@H]1NCCC.Cl |
| InChI | InChI=1S/C17H25NO.ClH/c1-4-7-14-11-13-8-6-9-17(19-3)15(13)12-16(14)18-10-5-2;/h4,6,8-9,14,16,18H,1,5,7,10-12H2,2-3H3;1H/t14-,16+;/m0./s1 |
| InChIKey | PQADNFVRNKBQCP-KUARMEPBSA-N |
| XLogP | 3.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|