C17H15N — CID 67749665
6,8-dimethyl-1,2-dihydroindeno[1,2-b]indole (PubChem CID 67749665) has the molecular formula C17H15N and a molecular weight of 233.31 g/mol. Its IUPAC name is 6,8-dimethyl-1,2-dihydroindeno[1,2-b]indole.
| Compound Name | 6,8-dimethyl-1,2-dihydroindeno[1,2-b]indole |
|---|---|
| PubChem CID | 67749665 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 6,8-dimethyl-1,2-dihydroindeno[1,2-b]indole |
| SMILES | Cc1cc(C)c2c(c1)=C1C=C3CCC=CC3=C1N=2 |
| InChI | InChI=1S/C17H15N/c1-10-7-11(2)16-14(8-10)15-9-12-5-3-4-6-13(12)17(15)18-16/h4,6-9H,3,5H2,1-2H3 |
| InChIKey | DYISCWAASFQTDX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |