About 2H-cyclopenta[d][1,3]oxazole;hydrochloride
2H-cyclopenta[d][1,3]oxazole;hydrochloride (PubChem CID 67750619) has the molecular formula C6H6ClNO
and a molecular weight of 143.57 g/mol. Its IUPAC name is 2H-cyclopenta[d][1,3]oxazole;hydrochloride.
Molecular Properties
| Compound Name | 2H-cyclopenta[d][1,3]oxazole;hydrochloride |
| PubChem CID | 67750619 |
| Molecular Formula | C6H6ClNO |
| Molecular Weight | 143.57 g/mol |
| Exact Mass | 143.01 |
| IUPAC Name | 2H-cyclopenta[d][1,3]oxazole;hydrochloride |
| SMILES | C1=CC2=NCOC2=C1.Cl |
| InChI | InChI=1S/C6H5NO.ClH/c1-2-5-6(3-1)8-4-7-5;/h1-3H,4H2;1H |
| InChIKey | CEBCSWDZZIHVKV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.57 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-cyclopenta[d][1,3]oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-cyclopenta[d][1,3]oxazole;hydrochloride?
The IUPAC name of 2H-cyclopenta[d][1,3]oxazole;hydrochloride (CID 67750619) is 2H-cyclopenta[d][1,3]oxazole;hydrochloride.
What is the SMILES notation for 2H-cyclopenta[d][1,3]oxazole;hydrochloride?
The canonical SMILES for 2H-cyclopenta[d][1,3]oxazole;hydrochloride is C1=CC2=NCOC2=C1.Cl.
What is the InChIKey of 2H-cyclopenta[d][1,3]oxazole;hydrochloride?
The InChIKey is CEBCSWDZZIHVKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO.ClH/c1-2-5-6(3-1)8-4-7-5;/h1-3H,4H2;1H.
What are the key properties of 2H-cyclopenta[d][1,3]oxazole;hydrochloride?
2H-cyclopenta[d][1,3]oxazole;hydrochloride has a molecular weight of 143.57 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-cyclopenta[d][1,3]oxazole;hydrochloride is sourced from PubChem (CID 67750619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).