C36H52N2O6 — CID 67750889
5-[[(4-tert-butylphenyl)methyl-decylamino]-(2,4-dimethoxyanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 67750889) has the molecular formula C36H52N2O6 and a molecular weight of 608.82 g/mol. Its IUPAC name is 5-[[(4-tert-butylphenyl)methyl-decylamino]-(2,4-dimethoxyanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[(4-tert-butylphenyl)methyl-decylamino]-(2,4-dimethoxyanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 67750889 |
| Molecular Formula | C36H52N2O6 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.38 |
| IUPAC Name | 5-[[(4-tert-butylphenyl)methyl-decylamino]-(2,4-dimethoxyanilino)methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CCCCCCCCCCN(Cc1ccc(C(C)(C)C)cc1)C(Nc1ccc(OC)cc1OC)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C36H52N2O6/c1-9-10-11-12-13-14-15-16-23-38(25-26-17-19-27(20-18-26)35(2,3)4)32(31-33(39)43-36(5,6)44-34(31)40)37-29-22-21-28(41-7)24-30(29)42-8/h17-22,24,37H,9-16,23,25H2,1-8H3 |
| InChIKey | KGHTWMPQGXSNEC-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|