C15H8N2O3 — CID 67751243
8-oxo-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene-14-carboxylic acid (PubChem CID 67751243) has the molecular formula C15H8N2O3 and a molecular weight of 264.24 g/mol. Its IUPAC name is 8-oxo-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene-14-carboxylic acid.
| Compound Name | 8-oxo-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene-14-carboxylic acid |
|---|---|
| PubChem CID | 67751243 |
| Molecular Formula | C15H8N2O3 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 8-oxo-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9(16),10,12,14-heptaene-14-carboxylic acid |
| SMILES | O=C(O)c1nn2c3ccccc3c(=O)c3cccc1c32 |
| InChI | InChI=1S/C15H8N2O3/c18-14-8-4-1-2-7-11(8)17-13-9(5-3-6-10(13)14)12(16-17)15(19)20/h1-7H,(H,19,20) |
| InChIKey | NKUYBXIQXWVSHD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|