C20H21N3O4 — CID 67751303
14-[[bis(2-hydroxyethyl)amino]methyl]-10-methoxy-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one (PubChem CID 67751303) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 14-[[bis(2-hydroxyethyl)amino]methyl]-10-methoxy-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one.
| Compound Name | 14-[[bis(2-hydroxyethyl)amino]methyl]-10-methoxy-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one |
|---|---|
| PubChem CID | 67751303 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 14-[[bis(2-hydroxyethyl)amino]methyl]-10-methoxy-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one |
| SMILES | COc1ccc2c(CN(CCO)CCO)nn3c4ccccc4c(=O)c1c23 |
| InChI | InChI=1S/C20H21N3O4/c1-27-17-7-6-13-15(12-22(8-10-24)9-11-25)21-23-16-5-3-2-4-14(16)20(26)18(17)19(13)23/h2-7,24-25H,8-12H2,1H3 |
| InChIKey | BBKRRTPPKMWTFQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|