C21H25N5OS — CID 67751404
14-(2-aminoethylsulfanylmethyl)-10-[2-(dimethylamino)ethylamino]-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one (PubChem CID 67751404) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is 14-(2-aminoethylsulfanylmethyl)-10-[2-(dimethylamino)ethylamino]-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one.
| Compound Name | 14-(2-aminoethylsulfanylmethyl)-10-[2-(dimethylamino)ethylamino]-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one |
|---|---|
| PubChem CID | 67751404 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 14-(2-aminoethylsulfanylmethyl)-10-[2-(dimethylamino)ethylamino]-1,15-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaen-8-one |
| SMILES | CN(C)CCNc1ccc2c(CSCCN)nn3c4ccccc4c(=O)c1c23 |
| InChI | InChI=1S/C21H25N5OS/c1-25(2)11-10-23-16-8-7-14-17(13-28-12-9-22)24-26-18-6-4-3-5-15(18)21(27)19(16)20(14)26/h3-8,23H,9-13,22H2,1-2H3 |
| InChIKey | RDXXBTWUBSOESI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 75.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|