C21H37N3O4Si — CID 67752035
prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[4-(hydroxymethyl)-1-methylpyrazol-5-yl]ethyl]pyrrolidine-1-carboxylate (PubChem CID 67752035) has the molecular formula C21H37N3O4Si and a molecular weight of 423.63 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[4-(hydroxymethyl)-1-methylpyrazol-5-yl]ethyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[4-(hydroxymethyl)-1-methylpyrazol-5-yl]ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67752035 |
| Molecular Formula | C21H37N3O4Si |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | prop-2-enyl (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[2-[4-(hydroxymethyl)-1-methylpyrazol-5-yl]ethyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1CCc1c(CO)cnn1C |
| InChI | InChI=1S/C21H37N3O4Si/c1-8-11-27-20(26)24-14-18(28-29(6,7)21(2,3)4)12-17(24)9-10-19-16(15-25)13-22-23(19)5/h8,13,17-18,25H,1,9-12,14-15H2,2-7H3/t17-,18-/m1/s1 |
| InChIKey | DKPQIBCFFPPHPL-QZTJIDSGSA-N |
| XLogP | 3.63 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|