C20H17FN2O3S2 — CID 67752671
2-[2-[1-[2-(2-ethyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoic acid (PubChem CID 67752671) has the molecular formula C20H17FN2O3S2 and a molecular weight of 416.50 g/mol. Its IUPAC name is 2-[2-[1-[2-(2-ethyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoic acid.
| Compound Name | 2-[2-[1-[2-(2-ethyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 67752671 |
| Molecular Formula | C20H17FN2O3S2 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-[2-[1-[2-(2-ethyl-1,3-thiazol-4-yl)-1,3-thiazol-4-yl]-2-fluoroethenyl]phenyl]-3-methoxyprop-2-enoic acid |
| SMILES | CCc1nc(-c2nc(C(=CF)c3ccccc3C(=COC)C(=O)O)cs2)cs1 |
| InChI | InChI=1S/C20H17FN2O3S2/c1-3-18-22-17(11-27-18)19-23-16(10-28-19)14(8-21)12-6-4-5-7-13(12)15(9-26-2)20(24)25/h4-11H,3H2,1-2H3,(H,24,25) |
| InChIKey | UXNJGPBEVKJHDW-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|