About 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine
7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine (PubChem CID 67753199) has the molecular formula C9H11FN2O
and a molecular weight of 182.20 g/mol. Its IUPAC name is 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine.
Molecular Properties
| Compound Name | 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine |
| PubChem CID | 67753199 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine |
| SMILES | CC1COc2cc(F)cc(N)c2N1 |
| InChI | InChI=1S/C9H11FN2O/c1-5-4-13-8-3-6(10)2-7(11)9(8)12-5/h2-3,5,12H,4,11H2,1H3 |
| InChIKey | SOPUKLZQTCAERK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine?
The IUPAC name of 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine (CID 67753199) is 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine.
What is the SMILES notation for 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine?
The canonical SMILES for 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine is CC1COc2cc(F)cc(N)c2N1.
What is the InChIKey of 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine?
The InChIKey is SOPUKLZQTCAERK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2O/c1-5-4-13-8-3-6(10)2-7(11)9(8)12-5/h2-3,5,12H,4,11H2,1H3.
What are the key properties of 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine?
7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine has a molecular weight of 182.20 g/mol, XLogP of 1.60, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-3-methyl-3,4-dihydro-2H-1,4-benzoxazin-5-amine is sourced from PubChem (CID 67753199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).