About 3,6-dihydro-1H-thieno[3,4-d]azepine
3,6-dihydro-1H-thieno[3,4-d]azepine (PubChem CID 67753476) has the molecular formula C8H9NS
and a molecular weight of 151.23 g/mol. Its IUPAC name is 3,6-dihydro-1H-thieno[3,4-d]azepine.
Molecular Properties
| Compound Name | 3,6-dihydro-1H-thieno[3,4-d]azepine |
| PubChem CID | 67753476 |
| Molecular Formula | C8H9NS |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 3,6-dihydro-1H-thieno[3,4-d]azepine |
| SMILES | C1=CC2=C(C=CN1)CSC2 |
| InChI | InChI=1S/C8H9NS/c1-3-9-4-2-8-6-10-5-7(1)8/h1-4,9H,5-6H2 |
| InChIKey | JEWMCWPGUBLPQV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dihydro-1H-thieno[3,4-d]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dihydro-1H-thieno[3,4-d]azepine?
The IUPAC name of 3,6-dihydro-1H-thieno[3,4-d]azepine (CID 67753476) is 3,6-dihydro-1H-thieno[3,4-d]azepine.
What is the SMILES notation for 3,6-dihydro-1H-thieno[3,4-d]azepine?
The canonical SMILES for 3,6-dihydro-1H-thieno[3,4-d]azepine is C1=CC2=C(C=CN1)CSC2.
What is the InChIKey of 3,6-dihydro-1H-thieno[3,4-d]azepine?
The InChIKey is JEWMCWPGUBLPQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NS/c1-3-9-4-2-8-6-10-5-7(1)8/h1-4,9H,5-6H2.
What are the key properties of 3,6-dihydro-1H-thieno[3,4-d]azepine?
3,6-dihydro-1H-thieno[3,4-d]azepine has a molecular weight of 151.23 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dihydro-1H-thieno[3,4-d]azepine is sourced from PubChem (CID 67753476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).