About 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol
2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol (PubChem CID 677535) has the molecular formula C14H11N3O
and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol.
Molecular Properties
| Compound Name | 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol |
| PubChem CID | 677535 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol |
| SMILES | Oc1ccccc1-c1nc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C14H11N3O/c18-12-9-5-4-8-11(12)14-15-13(16-17-14)10-6-2-1-3-7-10/h1-9,18H,(H,15,16,17) |
| InChIKey | YTGNKUSFDPGOIS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol?
The IUPAC name of 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol (CID 677535) is 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol.
What is the SMILES notation for 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol?
The canonical SMILES for 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol is Oc1ccccc1-c1nc(-c2ccccc2)n[nH]1.
What is the InChIKey of 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol?
The InChIKey is YTGNKUSFDPGOIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3O/c18-12-9-5-4-8-11(12)14-15-13(16-17-14)10-6-2-1-3-7-10/h1-9,18H,(H,15,16,17).
What are the key properties of 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol?
2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol has a molecular weight of 237.26 g/mol, XLogP of 2.84, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-phenyl-1H-1,2,4-triazol-5-yl)phenol is sourced from PubChem (CID 677535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).