C24H40O8 — CID 67753557
(1R,2R,4R,7R,8S,9R,10R,12R,14S)-7-ethyl-8,9-dihydroxy-14-methoxy-2,4,8,10,12,16-hexamethyl-6,17-dioxabicyclo[12.3.0]heptadecane-3,5,11-trione (PubChem CID 67753557) has the molecular formula C24H40O8 and a molecular weight of 456.58 g/mol. Its IUPAC name is (1R,2R,4R,7R,8S,9R,10R,12R,14S)-7-ethyl-8,9-dihydroxy-14-methoxy-2,4,8,10,12,16-hexamethyl-6,17-dioxabicyclo[12.3.0]heptadecane-3,5,11-trione.
| Compound Name | (1R,2R,4R,7R,8S,9R,10R,12R,14S)-7-ethyl-8,9-dihydroxy-14-methoxy-2,4,8,10,12,16-hexamethyl-6,17-dioxabicyclo[12.3.0]heptadecane-3,5,11-trione |
|---|---|
| PubChem CID | 67753557 |
| Molecular Formula | C24H40O8 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | (1R,2R,4R,7R,8S,9R,10R,12R,14S)-7-ethyl-8,9-dihydroxy-14-methoxy-2,4,8,10,12,16-hexamethyl-6,17-dioxabicyclo[12.3.0]heptadecane-3,5,11-trione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C(=O)[C@H](C)[C@H]2OC(C)C[C@@]2(OC)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C24H40O8/c1-9-17-23(7,29)20(27)14(4)18(25)12(2)10-24(30-8)11-13(3)31-21(24)15(5)19(26)16(6)22(28)32-17/h12-17,20-21,27,29H,9-11H2,1-8H3/t12-,13?,14+,15+,16-,17-,20-,21-,23-,24+/m1/s1 |
| InChIKey | XAHKIARESYTKIA-JXOOHSARSA-N |
| XLogP | 2.07 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|