About 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile
2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile (PubChem CID 67753983) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile.
Molecular Properties
| Compound Name | 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile |
| PubChem CID | 67753983 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile |
| SMILES | C=CCc1nc(C#N)n(CCCCC)n1 |
| InChI | InChI=1S/C11H16N4/c1-3-5-6-8-15-11(9-12)13-10(14-15)7-4-2/h4H,2-3,5-8H2,1H3 |
| InChIKey | NXRYOYSJJKQHHY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile (CID 67753983) is 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile is C=CCc1nc(C#N)n(CCCCC)n1.
What is the InChIKey of 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile?
The InChIKey is NXRYOYSJJKQHHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4/c1-3-5-6-8-15-11(9-12)13-10(14-15)7-4-2/h4H,2-3,5-8H2,1H3.
What are the key properties of 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile?
2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile has a molecular weight of 204.28 g/mol, XLogP of 2.07, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentyl-5-prop-2-enyl-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 67753983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).