About acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol
acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol (PubChem CID 67754208) has the molecular formula C19H26N4O4
and a molecular weight of 374.44 g/mol. Its IUPAC name is acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol.
Molecular Properties
| Compound Name | acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol |
| PubChem CID | 67754208 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol |
| SMILES | CC(=O)O.O[C@H]1CCC[C@H]1Oc1nc(N2CCNCC2)nc2ccccc12 |
| InChI | InChI=1S/C17H22N4O2.C2H4O2/c22-14-6-3-7-15(14)23-16-12-4-1-2-5-13(12)19-17(20-16)21-10-8-18-9-11-21;1-2(3)4/h1-2,4-5,14-15,18,22H,3,6-11H2;1H3,(H,3,4)/t14-,15+;/m0./s1 |
| InChIKey | LLFYIYAYLGOALJ-LDXVYITESA-N |
| XLogP | 1.42 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol?
The IUPAC name of acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol (CID 67754208) is acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol.
What is the SMILES notation for acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol?
The canonical SMILES for acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol is CC(=O)O.O[C@H]1CCC[C@H]1Oc1nc(N2CCNCC2)nc2ccccc12.
What is the InChIKey of acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol?
The InChIKey is LLFYIYAYLGOALJ-LDXVYITESA-N. The full InChI is InChI=1S/C17H22N4O2.C2H4O2/c22-14-6-3-7-15(14)23-16-12-4-1-2-5-13(12)19-17(20-16)21-10-8-18-9-11-21;1-2(3)4/h1-2,4-5,14-15,18,22H,3,6-11H2;1H3,(H,3,4)/t14-,15+;/m0./s1.
What are the key properties of acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol?
acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol has a molecular weight of 374.44 g/mol, XLogP of 1.42, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;cis-(1S,2R)-2-(2-piperazin-1-ylquinazolin-4-yl)oxycyclopentan-1-ol is sourced from PubChem (CID 67754208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).