About 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one
2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one (PubChem CID 67754228) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one.
Molecular Properties
| Compound Name | 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one |
| PubChem CID | 67754228 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one |
| SMILES | O=C1CC=CC2=CN(C3CCNCC3)CC12 |
| InChI | InChI=1S/C13H18N2O/c16-13-3-1-2-10-8-15(9-12(10)13)11-4-6-14-7-5-11/h1-2,8,11-12,14H,3-7,9H2 |
| InChIKey | AFTWYRLKAIYZHC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one?
The IUPAC name of 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one (CID 67754228) is 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one.
What is the SMILES notation for 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one?
The canonical SMILES for 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one is O=C1CC=CC2=CN(C3CCNCC3)CC12.
What is the InChIKey of 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one?
The InChIKey is AFTWYRLKAIYZHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c16-13-3-1-2-10-8-15(9-12(10)13)11-4-6-14-7-5-11/h1-2,8,11-12,14H,3-7,9H2.
What are the key properties of 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one?
2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one has a molecular weight of 218.30 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-yl-3a,5-dihydro-3H-isoindol-4-one is sourced from PubChem (CID 67754228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).