About 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one
4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one (PubChem CID 67754658) has the molecular formula C13H24N4O
and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one.
Molecular Properties
| Compound Name | 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one |
| PubChem CID | 67754658 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one |
| SMILES | CN1CCC(=O)CC1.CN1CCC(N)(C#N)CC1 |
| InChI | InChI=1S/C7H13N3.C6H11NO/c1-10-4-2-7(9,6-8)3-5-10;1-7-4-2-6(8)3-5-7/h2-5,9H2,1H3;2-5H2,1H3 |
| InChIKey | QFCPKLRJWIIWCX-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one?
The IUPAC name of 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one (CID 67754658) is 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one.
What is the SMILES notation for 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one?
The canonical SMILES for 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one is CN1CCC(=O)CC1.CN1CCC(N)(C#N)CC1.
What is the InChIKey of 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one?
The InChIKey is QFCPKLRJWIIWCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3.C6H11NO/c1-10-4-2-7(9,6-8)3-5-10;1-7-4-2-6(8)3-5-7/h2-5,9H2,1H3;2-5H2,1H3.
What are the key properties of 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one?
4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one has a molecular weight of 252.36 g/mol, XLogP of 0.21, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-methylpiperidine-4-carbonitrile;1-methylpiperidin-4-one is sourced from PubChem (CID 67754658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).