C25H40N4O4 — CID 67754967
(2R,4S,5S)-9-(3-acetyl-2H-benzimidazol-1-yl)-5-amino-N-butyl-4-hydroxy-2,7,7-trimethyl-9-oxononanamide (PubChem CID 67754967) has the molecular formula C25H40N4O4 and a molecular weight of 460.62 g/mol. Its IUPAC name is (2R,4S,5S)-9-(3-acetyl-2H-benzimidazol-1-yl)-5-amino-N-butyl-4-hydroxy-2,7,7-trimethyl-9-oxononanamide.
| Compound Name | (2R,4S,5S)-9-(3-acetyl-2H-benzimidazol-1-yl)-5-amino-N-butyl-4-hydroxy-2,7,7-trimethyl-9-oxononanamide |
|---|---|
| PubChem CID | 67754967 |
| Molecular Formula | C25H40N4O4 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (2R,4S,5S)-9-(3-acetyl-2H-benzimidazol-1-yl)-5-amino-N-butyl-4-hydroxy-2,7,7-trimethyl-9-oxononanamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)CC(C)(C)CC(=O)N1CN(C(C)=O)c2ccccc21 |
| InChI | InChI=1S/C25H40N4O4/c1-6-7-12-27-24(33)17(2)13-22(31)19(26)14-25(4,5)15-23(32)29-16-28(18(3)30)20-10-8-9-11-21(20)29/h8-11,17,19,22,31H,6-7,12-16,26H2,1-5H3,(H,27,33)/t17-,19+,22+/m1/s1 |
| InChIKey | ZKOUQFYKHJXPGW-LZNRXBQRSA-N |
| XLogP | 2.78 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|