C28H46N4O4 — CID 67755509
(3R)-1-[(5S,6S,8R)-5-amino-9-(butylamino)-6-hydroxy-3,3,8-trimethyl-9-oxononanoyl]-N,N-dimethyl-3,4-dihydro-2H-quinoline-3-carboxamide (PubChem CID 67755509) has the molecular formula C28H46N4O4 and a molecular weight of 502.70 g/mol. Its IUPAC name is (3R)-1-[(5S,6S,8R)-5-amino-9-(butylamino)-6-hydroxy-3,3,8-trimethyl-9-oxononanoyl]-N,N-dimethyl-3,4-dihydro-2H-quinoline-3-carboxamide.
| Compound Name | (3R)-1-[(5S,6S,8R)-5-amino-9-(butylamino)-6-hydroxy-3,3,8-trimethyl-9-oxononanoyl]-N,N-dimethyl-3,4-dihydro-2H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 67755509 |
| Molecular Formula | C28H46N4O4 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.35 |
| IUPAC Name | (3R)-1-[(5S,6S,8R)-5-amino-9-(butylamino)-6-hydroxy-3,3,8-trimethyl-9-oxononanoyl]-N,N-dimethyl-3,4-dihydro-2H-quinoline-3-carboxamide |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)CC(C)(C)CC(=O)N1C[C@H](C(=O)N(C)C)Cc2ccccc21 |
| InChI | InChI=1S/C28H46N4O4/c1-7-8-13-30-26(35)19(2)14-24(33)22(29)16-28(3,4)17-25(34)32-18-21(27(36)31(5)6)15-20-11-9-10-12-23(20)32/h9-12,19,21-22,24,33H,7-8,13-18,29H2,1-6H3,(H,30,35)/t19-,21-,22+,24+/m1/s1 |
| InChIKey | CKPHFWXOIIVKRM-VLHNPEIBSA-N |
| XLogP | 2.72 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|