C35H38F2N2O5S — CID 67755562
5-[4-[4-[bis(4-fluorophenyl)methylidene]piperidin-1-yl]butyl]-2-methyl-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one;but-2-enedioic acid (PubChem CID 67755562) has the molecular formula C35H38F2N2O5S and a molecular weight of 636.76 g/mol. Its IUPAC name is 5-[4-[4-[bis(4-fluorophenyl)methylidene]piperidin-1-yl]butyl]-2-methyl-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one;but-2-enedioic acid.
| Compound Name | 5-[4-[4-[bis(4-fluorophenyl)methylidene]piperidin-1-yl]butyl]-2-methyl-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one;but-2-enedioic acid |
|---|---|
| PubChem CID | 67755562 |
| Molecular Formula | C35H38F2N2O5S |
| Molecular Weight | 636.76 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | 5-[4-[4-[bis(4-fluorophenyl)methylidene]piperidin-1-yl]butyl]-2-methyl-7,8-dihydro-6H-thieno[3,2-c]azepin-4-one;but-2-enedioic acid |
| SMILES | Cc1cc2c(s1)CCCN(CCCCN1CCC(=C(c3ccc(F)cc3)c3ccc(F)cc3)CC1)C2=O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C31H34F2N2OS.C4H4O4/c1-22-21-28-29(37-22)5-4-18-35(31(28)36)17-3-2-16-34-19-14-25(15-20-34)30(23-6-10-26(32)11-7-23)24-8-12-27(33)13-9-24;5-3(6)1-2-4(7)8/h6-13,21H,2-5,14-20H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | SHUUQDYXEHVQBV-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.76 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|