C17H23NO6 — CID 67755895
[(1S,6R,7R,8S,9S,9aS)-7,8,9-trihydroxy-6-(hydroxymethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl] benzoate (PubChem CID 67755895) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is [(1S,6R,7R,8S,9S,9aS)-7,8,9-trihydroxy-6-(hydroxymethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl] benzoate.
| Compound Name | [(1S,6R,7R,8S,9S,9aS)-7,8,9-trihydroxy-6-(hydroxymethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl] benzoate |
|---|---|
| PubChem CID | 67755895 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [(1S,6R,7R,8S,9S,9aS)-7,8,9-trihydroxy-6-(hydroxymethyl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl] benzoate |
| SMILES | O=C(O[C@H]1CCCN2[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)c1ccccc1 |
| InChI | InChI=1S/C17H23NO6/c19-9-11-14(20)16(22)15(21)13-12(7-4-8-18(11)13)24-17(23)10-5-2-1-3-6-10/h1-3,5-6,11-16,19-22H,4,7-9H2/t11-,12+,13-,14-,15+,16+/m1/s1 |
| InChIKey | LFRADAQNTJGXBL-UKRFAEJPSA-N |
| XLogP | -0.87 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |