C20H24N2O8S — CID 67756103
(5R,8S)-16-hydroxy-14-methoxy-7,11-dioxo-8-(pent-4-enoylamino)-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxylic acid (PubChem CID 67756103) has the molecular formula C20H24N2O8S and a molecular weight of 452.49 g/mol. Its IUPAC name is (5R,8S)-16-hydroxy-14-methoxy-7,11-dioxo-8-(pent-4-enoylamino)-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxylic acid.
| Compound Name | (5R,8S)-16-hydroxy-14-methoxy-7,11-dioxo-8-(pent-4-enoylamino)-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 67756103 |
| Molecular Formula | C20H24N2O8S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (5R,8S)-16-hydroxy-14-methoxy-7,11-dioxo-8-(pent-4-enoylamino)-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxylic acid |
| SMILES | C=CCCC(=O)N[C@H]1COC(=O)c2cc(OC)cc(O)c2CSC[C@@H](C(=O)O)NC1=O |
| InChI | InChI=1S/C20H24N2O8S/c1-3-4-5-17(24)21-14-8-30-20(28)12-6-11(29-2)7-16(23)13(12)9-31-10-15(19(26)27)22-18(14)25/h3,6-7,14-15,23H,1,4-5,8-10H2,2H3,(H,21,24)(H,22,25)(H,26,27)/t14-,15-/m0/s1 |
| InChIKey | WOPYIZKGGKOIDI-GJZGRUSLSA-N |
| XLogP | 0.82 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|