C21H24N2O5 — CID 67756377
(Z)-but-2-enedioic acid;9-ethyl-6-oxa-9,17-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(18),2,4,10,16-pentaene (PubChem CID 67756377) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;9-ethyl-6-oxa-9,17-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(18),2,4,10,16-pentaene.
| Compound Name | (Z)-but-2-enedioic acid;9-ethyl-6-oxa-9,17-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(18),2,4,10,16-pentaene |
|---|---|
| PubChem CID | 67756377 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;9-ethyl-6-oxa-9,17-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(18),2,4,10,16-pentaene |
| SMILES | CCN1CCOc2cccc3nc4c(c1c23)CCCC4.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H20N2O.C4H4O4/c1-2-19-10-11-20-15-9-5-8-14-16(15)17(19)12-6-3-4-7-13(12)18-14;5-3(6)1-2-4(7)8/h5,8-9H,2-4,6-7,10-11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | JEVAJUONYJNJGH-BTJKTKAUSA-N |
| XLogP | 3.04 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|