C22H26N2O5 — CID 67756603
(E)-but-2-enedioic acid;7-ethyl-9-methyl-6-oxa-9,17-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(18),2,4,10,16-pentaene (PubChem CID 67756603) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;7-ethyl-9-methyl-6-oxa-9,17-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(18),2,4,10,16-pentaene.
| Compound Name | (E)-but-2-enedioic acid;7-ethyl-9-methyl-6-oxa-9,17-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(18),2,4,10,16-pentaene |
|---|---|
| PubChem CID | 67756603 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (E)-but-2-enedioic acid;7-ethyl-9-methyl-6-oxa-9,17-diazatetracyclo[8.7.1.05,18.011,16]octadeca-1(18),2,4,10,16-pentaene |
| SMILES | CCC1CN(C)c2c3c(nc4cccc(c24)O1)CCCC3.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H22N2O.C4H4O4/c1-3-12-11-20(2)18-13-7-4-5-8-14(13)19-15-9-6-10-16(21-12)17(15)18;5-3(6)1-2-4(7)8/h6,9-10,12H,3-5,7-8,11H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | RJZKHNYCXVPAQS-WLHGVMLRSA-N |
| XLogP | 3.43 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|