About 7,7-dimethylazepin-2-amine
7,7-dimethylazepin-2-amine (PubChem CID 67756668) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 7,7-dimethylazepin-2-amine.
Molecular Properties
| Compound Name | 7,7-dimethylazepin-2-amine |
| PubChem CID | 67756668 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 7,7-dimethylazepin-2-amine |
| SMILES | CC1(C)C=CC=CC(N)=N1 |
| InChI | InChI=1S/C8H12N2/c1-8(2)6-4-3-5-7(9)10-8/h3-6H,1-2H3,(H2,9,10) |
| InChIKey | AKEQKPJDDIHISZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,7-dimethylazepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethylazepin-2-amine?
The IUPAC name of 7,7-dimethylazepin-2-amine (CID 67756668) is 7,7-dimethylazepin-2-amine.
What is the SMILES notation for 7,7-dimethylazepin-2-amine?
The canonical SMILES for 7,7-dimethylazepin-2-amine is CC1(C)C=CC=CC(N)=N1.
What is the InChIKey of 7,7-dimethylazepin-2-amine?
The InChIKey is AKEQKPJDDIHISZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-8(2)6-4-3-5-7(9)10-8/h3-6H,1-2H3,(H2,9,10).
What are the key properties of 7,7-dimethylazepin-2-amine?
7,7-dimethylazepin-2-amine has a molecular weight of 136.20 g/mol, XLogP of 1.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethylazepin-2-amine is sourced from PubChem (CID 67756668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).