C10H18N2O3 — CID 67756705
ethyl (6-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl) carbonate (PubChem CID 67756705) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl (6-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl) carbonate.
| Compound Name | ethyl (6-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl) carbonate |
|---|---|
| PubChem CID | 67756705 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | ethyl (6-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl) carbonate |
| SMILES | CCOC(=O)ON1CC2CCNC2C1C |
| InChI | InChI=1S/C10H18N2O3/c1-3-14-10(13)15-12-6-8-4-5-11-9(8)7(12)2/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | BYKXWVHIXKASDU-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |