About carbamic acid;cyclohex-3-en-1-imine
carbamic acid;cyclohex-3-en-1-imine (PubChem CID 67757658) has the molecular formula C8H15N3O4
and a molecular weight of 217.23 g/mol. Its IUPAC name is carbamic acid;cyclohex-3-en-1-imine.
Molecular Properties
| Compound Name | carbamic acid;cyclohex-3-en-1-imine |
| PubChem CID | 67757658 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | carbamic acid;cyclohex-3-en-1-imine |
| SMILES | NC(=O)O.NC(=O)O.[H]/N=C1\CC=CCC1 |
| InChI | InChI=1S/C6H9N.2CH3NO2/c7-6-4-2-1-3-5-6;2*2-1(3)4/h1-2,7H,3-5H2;2*2H2,(H,3,4)/b7-6+;; |
| InChIKey | ZWAGPDZXWADVTD-KMXZHCNGSA-N |
| XLogP | 0.99 |
| TPSA | 150.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;cyclohex-3-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;cyclohex-3-en-1-imine?
The IUPAC name of carbamic acid;cyclohex-3-en-1-imine (CID 67757658) is carbamic acid;cyclohex-3-en-1-imine.
What is the SMILES notation for carbamic acid;cyclohex-3-en-1-imine?
The canonical SMILES for carbamic acid;cyclohex-3-en-1-imine is NC(=O)O.NC(=O)O.[H]/N=C1\CC=CCC1.
What is the InChIKey of carbamic acid;cyclohex-3-en-1-imine?
The InChIKey is ZWAGPDZXWADVTD-KMXZHCNGSA-N. The full InChI is InChI=1S/C6H9N.2CH3NO2/c7-6-4-2-1-3-5-6;2*2-1(3)4/h1-2,7H,3-5H2;2*2H2,(H,3,4)/b7-6+;;.
What are the key properties of carbamic acid;cyclohex-3-en-1-imine?
carbamic acid;cyclohex-3-en-1-imine has a molecular weight of 217.23 g/mol, XLogP of 0.99, 0 rotatable bonds, 5 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;cyclohex-3-en-1-imine is sourced from PubChem (CID 67757658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).