About [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate
[11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate (PubChem CID 67757702) has the molecular formula C26H22N2O4
and a molecular weight of 426.47 g/mol. Its IUPAC name is [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate.
Molecular Properties
| Compound Name | [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate |
| PubChem CID | 67757702 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate |
| SMILES | Cc1ccc(C)c2c1ncn2CC=C1c2ccccc2COc2ccc(OC(=O)O)cc21 |
| InChI | InChI=1S/C26H22N2O4/c1-16-7-8-17(2)25-24(16)27-15-28(25)12-11-21-20-6-4-3-5-18(20)14-31-23-10-9-19(13-22(21)23)32-26(29)30/h3-11,13,15H,12,14H2,1-2H3,(H,29,30) |
| InChIKey | SRKAOFHZEAQQKQ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate?
The IUPAC name of [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate (CID 67757702) is [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate.
What is the SMILES notation for [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate?
The canonical SMILES for [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate is Cc1ccc(C)c2c1ncn2CC=C1c2ccccc2COc2ccc(OC(=O)O)cc21.
What is the InChIKey of [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate?
The InChIKey is SRKAOFHZEAQQKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N2O4/c1-16-7-8-17(2)25-24(16)27-15-28(25)12-11-21-20-6-4-3-5-18(20)14-31-23-10-9-19(13-22(21)23)32-26(29)30/h3-11,13,15H,12,14H2,1-2H3,(H,29,30).
What are the key properties of [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate?
[11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate has a molecular weight of 426.47 g/mol, XLogP of 5.73, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [11-[2-(4,7-dimethylbenzimidazol-1-yl)ethylidene]-6H-benzo[c][1]benzoxepin-2-yl] hydrogen carbonate is sourced from PubChem (CID 67757702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).