C7H9ClN4O2S — CID 67757903
(E)-1-N'-(2-chloro-1,3-thiazol-5-yl)-1-N,1-N'-dimethyl-2-nitroethene-1,1-diamine (PubChem CID 67757903) has the molecular formula C7H9ClN4O2S and a molecular weight of 248.70 g/mol. Its IUPAC name is (E)-1-N'-(2-chloro-1,3-thiazol-5-yl)-1-N,1-N'-dimethyl-2-nitroethene-1,1-diamine.
| Compound Name | (E)-1-N'-(2-chloro-1,3-thiazol-5-yl)-1-N,1-N'-dimethyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 67757903 |
| Molecular Formula | C7H9ClN4O2S |
| Molecular Weight | 248.70 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | (E)-1-N'-(2-chloro-1,3-thiazol-5-yl)-1-N,1-N'-dimethyl-2-nitroethene-1,1-diamine |
| SMILES | CN/C(=C\[N+](=O)[O-])N(C)c1cnc(Cl)s1 |
| InChI | InChI=1S/C7H9ClN4O2S/c1-9-5(4-12(13)14)11(2)6-3-10-7(8)15-6/h3-4,9H,1-2H3/b5-4+ |
| InChIKey | YHZGCLBQSQPTOB-SNAWJCMRSA-N |
| XLogP | 1.53 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.70 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|