C19H15ClO2 — CID 67758055
2-[(2Z)-2-(2-chloroethylidene)-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]acetic acid (PubChem CID 67758055) has the molecular formula C19H15ClO2 and a molecular weight of 310.78 g/mol. Its IUPAC name is 2-[(2Z)-2-(2-chloroethylidene)-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]acetic acid.
| Compound Name | 2-[(2Z)-2-(2-chloroethylidene)-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]acetic acid |
|---|---|
| PubChem CID | 67758055 |
| Molecular Formula | C19H15ClO2 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-[(2Z)-2-(2-chloroethylidene)-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc2c(c1)/C(=C\CCl)c1ccccc1C=C2 |
| InChI | InChI=1S/C19H15ClO2/c20-10-9-17-16-4-2-1-3-14(16)7-8-15-6-5-13(11-18(15)17)12-19(21)22/h1-9,11H,10,12H2,(H,21,22)/b17-9- |
| InChIKey | DJOFUPYCACHXJR-MFOYZWKCSA-N |
| XLogP | 4.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|