C22H24N2O4S — CID 67758505
but-2-enedioic acid;2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)-4H-indeno[1,2-d][1,3]thiazole (PubChem CID 67758505) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is but-2-enedioic acid;2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)-4H-indeno[1,2-d][1,3]thiazole.
| Compound Name | but-2-enedioic acid;2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)-4H-indeno[1,2-d][1,3]thiazole |
|---|---|
| PubChem CID | 67758505 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | but-2-enedioic acid;2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethyl)-4H-indeno[1,2-d][1,3]thiazole |
| SMILES | O=C(O)C=CC(=O)O.c1ccc2c(c1)Cc1sc(CC34CCCN3CCC4)nc1-2 |
| InChI | InChI=1S/C18H20N2S.C4H4O4/c1-2-6-14-13(5-1)11-15-17(14)19-16(21-15)12-18-7-3-9-20(18)10-4-8-18;5-3(6)1-2-4(7)8/h1-2,5-6H,3-4,7-12H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | VEZSNWBGTRZKKP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|