C11H8BrNOS2 — CID 67758513
1-[4-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]phenyl]ethanone (PubChem CID 67758513) has the molecular formula C11H8BrNOS2 and a molecular weight of 314.23 g/mol. Its IUPAC name is 1-[4-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]phenyl]ethanone.
| Compound Name | 1-[4-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]phenyl]ethanone |
|---|---|
| PubChem CID | 67758513 |
| Molecular Formula | C11H8BrNOS2 |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 312.92 |
| IUPAC Name | 1-[4-[(4-bromo-1,3-thiazol-2-yl)sulfanyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Sc2nc(Br)cs2)cc1 |
| InChI | InChI=1S/C11H8BrNOS2/c1-7(14)8-2-4-9(5-3-8)16-11-13-10(12)6-15-11/h2-6H,1H3 |
| InChIKey | LEEASCPUPFJBJA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |