About [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate
[(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate (PubChem CID 67758809) has the molecular formula C16H16BrNO4S
and a molecular weight of 398.28 g/mol. Its IUPAC name is [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate.
Molecular Properties
| Compound Name | [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate |
| PubChem CID | 67758809 |
| Molecular Formula | C16H16BrNO4S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1CN(c2cc3c(Br)cccc3s2)C(=O)O1 |
| InChI | InChI=1S/C16H16BrNO4S/c1-2-4-15(19)21-9-10-8-18(16(20)22-10)14-7-11-12(17)5-3-6-13(11)23-14/h3,5-7,10H,2,4,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | JIOUKPQRWPHFAC-SNVBAGLBSA-N |
| XLogP | 4.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate?
The IUPAC name of [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate (CID 67758809) is [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate.
What is the SMILES notation for [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate?
The canonical SMILES for [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate is CCCC(=O)OC[C@H]1CN(c2cc3c(Br)cccc3s2)C(=O)O1.
What is the InChIKey of [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate?
The InChIKey is JIOUKPQRWPHFAC-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H16BrNO4S/c1-2-4-15(19)21-9-10-8-18(16(20)22-10)14-7-11-12(17)5-3-6-13(11)23-14/h3,5-7,10H,2,4,8-9H2,1H3/t10-/m1/s1.
What are the key properties of [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate?
[(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate has a molecular weight of 398.28 g/mol, XLogP of 4.33, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-3-(4-bromo-1-benzothiophen-2-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl butanoate is sourced from PubChem (CID 67758809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).