C23H23N3O5 — CID 67758827
but-2-enedioic acid;(1-prop-2-enylindol-3-yl)-(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)methanone (PubChem CID 67758827) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is but-2-enedioic acid;(1-prop-2-enylindol-3-yl)-(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)methanone.
| Compound Name | but-2-enedioic acid;(1-prop-2-enylindol-3-yl)-(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)methanone |
|---|---|
| PubChem CID | 67758827 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | but-2-enedioic acid;(1-prop-2-enylindol-3-yl)-(4,5,6,7-tetrahydro-3H-benzimidazol-5-yl)methanone |
| SMILES | C=CCn1cc(C(=O)C2CCc3nc[nH]c3C2)c2ccccc21.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H19N3O.C4H4O4/c1-2-9-22-11-15(14-5-3-4-6-18(14)22)19(23)13-7-8-16-17(10-13)21-12-20-16;5-3(6)1-2-4(7)8/h2-6,11-13H,1,7-10H2,(H,20,21);1-2H,(H,5,6)(H,7,8) |
| InChIKey | HUGINIKVYVCIPP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|