C25H34N2O — CID 67758834
1-[5-[benzyl(ethyl)amino]pentyl]-5-propan-2-yl-3H-indol-2-one (PubChem CID 67758834) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is 1-[5-[benzyl(ethyl)amino]pentyl]-5-propan-2-yl-3H-indol-2-one.
| Compound Name | 1-[5-[benzyl(ethyl)amino]pentyl]-5-propan-2-yl-3H-indol-2-one |
|---|---|
| PubChem CID | 67758834 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 1-[5-[benzyl(ethyl)amino]pentyl]-5-propan-2-yl-3H-indol-2-one |
| SMILES | CCN(CCCCCN1C(=O)Cc2cc(C(C)C)ccc21)Cc1ccccc1 |
| InChI | InChI=1S/C25H34N2O/c1-4-26(19-21-11-7-5-8-12-21)15-9-6-10-16-27-24-14-13-22(20(2)3)17-23(24)18-25(27)28/h5,7-8,11-14,17,20H,4,6,9-10,15-16,18-19H2,1-3H3 |
| InChIKey | QGEDJUSJGASZHQ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|