C27H42O7 — CID 67758876
3,5-dimethyl-3,5-bis(1,5,6-trimethoxycyclohexa-2,4-dien-1-yl)heptan-4-one (PubChem CID 67758876) has the molecular formula C27H42O7 and a molecular weight of 478.63 g/mol. Its IUPAC name is 3,5-dimethyl-3,5-bis(1,5,6-trimethoxycyclohexa-2,4-dien-1-yl)heptan-4-one.
| Compound Name | 3,5-dimethyl-3,5-bis(1,5,6-trimethoxycyclohexa-2,4-dien-1-yl)heptan-4-one |
|---|---|
| PubChem CID | 67758876 |
| Molecular Formula | C27H42O7 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | 3,5-dimethyl-3,5-bis(1,5,6-trimethoxycyclohexa-2,4-dien-1-yl)heptan-4-one |
| SMILES | CCC(C)(C(=O)C(C)(CC)C1(OC)C=CC=C(OC)C1OC)C1(OC)C=CC=C(OC)C1OC |
| InChI | InChI=1S/C27H42O7/c1-11-24(3,26(33-9)17-13-15-19(29-5)21(26)31-7)23(28)25(4,12-2)27(34-10)18-14-16-20(30-6)22(27)32-8/h13-18,21-22H,11-12H2,1-10H3 |
| InChIKey | CLFDOBLHFJYLNQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |