About 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol
1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol (PubChem CID 67759052) has the molecular formula C11H14N2OS
and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol |
| PubChem CID | 67759052 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol |
| SMILES | Cc1ncsc1CC(O)c1ccn(C)c1 |
| InChI | InChI=1S/C11H14N2OS/c1-8-11(15-7-12-8)5-10(14)9-3-4-13(2)6-9/h3-4,6-7,10,14H,5H2,1-2H3 |
| InChIKey | ZQOUOUMUTYYROU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol?
The IUPAC name of 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol (CID 67759052) is 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol.
What is the SMILES notation for 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol?
The canonical SMILES for 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol is Cc1ncsc1CC(O)c1ccn(C)c1.
What is the InChIKey of 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol?
The InChIKey is ZQOUOUMUTYYROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS/c1-8-11(15-7-12-8)5-10(14)9-3-4-13(2)6-9/h3-4,6-7,10,14H,5H2,1-2H3.
What are the key properties of 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol?
1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol has a molecular weight of 222.31 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methylpyrrol-3-yl)-2-(4-methyl-1,3-thiazol-5-yl)ethanol is sourced from PubChem (CID 67759052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).